| Name | 1-Chlorophthalazine |
| Synonyms | NSC 71104 CCRIS 7361 1-Chlorophthalazine 1-Chloro-phthalazine Phthalazine, 1-chloro- Hydralazine IMpurity 02 1-Chloro-2,3-benzodiazine Hydralazine Chloro IMpurity 5-(2-methylphenyl)-1H-pyrazol-3-amine 1-ChlorophthalazineDiscontinued See C379660 3-(4-ethoxyphenyl)-N'-[(1E,2E)-3-phenylprop-2-en-1-ylidene]-1H-pyrazole-5-carbohydrazide |
| CAS | 5784-45-2 |
| InChI | InChI=1/C10H11N3/c1-7-4-2-3-5-8(7)9-6-10(11)13-12-9/h2-6H,1H3,(H3,11,12,13) |
| Molecular Formula | C8H5ClN2 |
| Molar Mass | 164.59 |
| Density | 1.349±0.06 g/cm3(Predicted) |
| Melting Point | 109-112°C |
| Boling Point | 364.3±15.0 °C(Predicted) |
| Flash Point | 233.8°C |
| Water Solubility | Insoluble in water. Soluble in dichloromethane, ethanol and methanol. |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Vapor Presure | 4.43E-07mmHg at 25°C |
| Appearance | Solid |
| Color | Yellow to Dark Yellow |
| pKa | 1.74±0.10(Predicted) |
| Storage Condition | -20°C Freezer |
| Stability | Moisture Sensitive |
| Sensitive | Moisture Sensitive |
| Refractive Index | 1.643 |
| MDL | MFCD00024141 |
| Hazard Symbols | Xi - Irritant![]() |